C15H35FSi3 — CID 15303155
bis(trimethylsilyl)methyl-tert-butyl-fluoro-(2-methylprop-2-enyl)silane (PubChem CID 15303155) has the molecular formula C15H35FSi3 and a molecular weight of 318.70 g/mol. Its IUPAC name is bis(trimethylsilyl)methyl-tert-butyl-fluoro-(2-methylprop-2-enyl)silane.
| Compound Name | bis(trimethylsilyl)methyl-tert-butyl-fluoro-(2-methylprop-2-enyl)silane |
|---|---|
| PubChem CID | 15303155 |
| Molecular Formula | C15H35FSi3 |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | bis(trimethylsilyl)methyl-tert-butyl-fluoro-(2-methylprop-2-enyl)silane |
| SMILES | C=C(C)C[Si](F)(C([Si](C)(C)C)[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H35FSi3/c1-13(2)12-19(16,15(3,4)5)14(17(6,7)8)18(9,10)11/h14H,1,12H2,2-11H3 |
| InChIKey | VKANKRPPNZKRJZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|