C20H46Si5 — CID 54302434
[1,1-diethyl-2,4,5-tris(trimethylsilyl)silol-3-yl]-trimethylsilane (PubChem CID 54302434) has the molecular formula C20H46Si5 and a molecular weight of 427.02 g/mol. Its IUPAC name is [1,1-diethyl-2,4,5-tris(trimethylsilyl)silol-3-yl]-trimethylsilane.
| Compound Name | [1,1-diethyl-2,4,5-tris(trimethylsilyl)silol-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 54302434 |
| Molecular Formula | C20H46Si5 |
| Molecular Weight | 427.02 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [1,1-diethyl-2,4,5-tris(trimethylsilyl)silol-3-yl]-trimethylsilane |
| SMILES | CC[Si]1(CC)C([Si](C)(C)C)=C([Si](C)(C)C)C([Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C20H46Si5/c1-15-25(16-2)19(23(9,10)11)17(21(3,4)5)18(22(6,7)8)20(25)24(12,13)14/h15-16H2,1-14H3 |
| InChIKey | SFEMJOVWVYOROZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.02 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|