C30H55BSi2Sn — CID 15495145
[3-diethylboranyl-5-[dimethyl(5-methylhex-1-ynyl)silyl]-4-ethyl-1,1-dimethylstannol-2-yl]-dimethyl-(5-methylhex-1-ynyl)silane (PubChem CID 15495145) has the molecular formula C30H55BSi2Sn and a molecular weight of 601.47 g/mol. Its IUPAC name is [3-diethylboranyl-5-[dimethyl(5-methylhex-1-ynyl)silyl]-4-ethyl-1,1-dimethylstannol-2-yl]-dimethyl-(5-methylhex-1-ynyl)silane.
| Compound Name | [3-diethylboranyl-5-[dimethyl(5-methylhex-1-ynyl)silyl]-4-ethyl-1,1-dimethylstannol-2-yl]-dimethyl-(5-methylhex-1-ynyl)silane |
|---|---|
| PubChem CID | 15495145 |
| Molecular Formula | C30H55BSi2Sn |
| Molecular Weight | 601.47 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | [3-diethylboranyl-5-[dimethyl(5-methylhex-1-ynyl)silyl]-4-ethyl-1,1-dimethylstannol-2-yl]-dimethyl-(5-methylhex-1-ynyl)silane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C#CCCC(C)C)[Sn](C)(C)C([Si](C)(C)C#CCCC(C)C)=C1CC |
| InChI | InChI=1S/C28H49BSi2.2CH3.Sn/c1-12-27(23-30(8,9)21-17-15-19-25(4)5)28(29(13-2)14-3)24-31(10,11)22-18-16-20-26(6)7;;;/h25-26H,12-16,19-20H2,1-11H3;2*1H3; |
| InChIKey | MLHVQICSLGCQAU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.47 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|