C20H38Si4 — CID 11828192
[3,6-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)hexa-1,3,4,5-tetraenyl]-trimethylsilane (PubChem CID 11828192) has the molecular formula C20H38Si4 and a molecular weight of 390.87 g/mol. Its IUPAC name is [3,6-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)hexa-1,3,4,5-tetraenyl]-trimethylsilane.
| Compound Name | [3,6-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)hexa-1,3,4,5-tetraenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11828192 |
| Molecular Formula | C20H38Si4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [3,6-bis(trimethylsilyl)-2-(2-trimethylsilylethynyl)hexa-1,3,4,5-tetraenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(=C[Si](C)(C)C)C(=C=C=C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H38Si4/c1-21(2,3)16-13-14-20(24(10,11)12)19(18-23(7,8)9)15-17-22(4,5)6/h16,18H,1-12H3/b19-18?,20-16- |
| InChIKey | STGGMGIEXDDXPN-ZUUIPTIXSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|