C18H34Si2 — CID 10267182
tert-butyl-[4-[tert-butyl(dimethyl)silyl]hexa-4,5-dien-1-ynyl]-dimethylsilane (PubChem CID 10267182) has the molecular formula C18H34Si2 and a molecular weight of 306.64 g/mol. Its IUPAC name is tert-butyl-[4-[tert-butyl(dimethyl)silyl]hexa-4,5-dien-1-ynyl]-dimethylsilane.
| Compound Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]hexa-4,5-dien-1-ynyl]-dimethylsilane |
|---|---|
| PubChem CID | 10267182 |
| Molecular Formula | C18H34Si2 |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]hexa-4,5-dien-1-ynyl]-dimethylsilane |
| SMILES | C=C=C(CC#C[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34Si2/c1-12-16(20(10,11)18(5,6)7)14-13-15-19(8,9)17(2,3)4/h1,14H2,2-11H3 |
| InChIKey | FAKFYSWDIGCPIT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|