C27H48Si3 — CID 102353043
3,3-bis(2-triethylsilylethynyl)pent-4-en-1-ynyl-triethylsilane (PubChem CID 102353043) has the molecular formula C27H48Si3 and a molecular weight of 456.94 g/mol. Its IUPAC name is 3,3-bis(2-triethylsilylethynyl)pent-4-en-1-ynyl-triethylsilane.
| Compound Name | 3,3-bis(2-triethylsilylethynyl)pent-4-en-1-ynyl-triethylsilane |
|---|---|
| PubChem CID | 102353043 |
| Molecular Formula | C27H48Si3 |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 3,3-bis(2-triethylsilylethynyl)pent-4-en-1-ynyl-triethylsilane |
| SMILES | C=CC(C#C[Si](CC)(CC)CC)(C#C[Si](CC)(CC)CC)C#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H48Si3/c1-11-27(21-24-28(12-2,13-3)14-4,22-25-29(15-5,16-6)17-7)23-26-30(18-8,19-9)20-10/h11H,1,12-20H2,2-10H3 |
| InChIKey | SJQDHCRQKHPQFU-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|