C24H40Si2 — CID 102473890
trimethyl-[(3E,7E,11E)-2,2,13,13-tetramethyl-8-trimethylsilyltetradeca-3,7,11-trien-5,9-diyn-7-yl]silane (PubChem CID 102473890) has the molecular formula C24H40Si2 and a molecular weight of 384.76 g/mol. Its IUPAC name is trimethyl-[(3E,7E,11E)-2,2,13,13-tetramethyl-8-trimethylsilyltetradeca-3,7,11-trien-5,9-diyn-7-yl]silane.
| Compound Name | trimethyl-[(3E,7E,11E)-2,2,13,13-tetramethyl-8-trimethylsilyltetradeca-3,7,11-trien-5,9-diyn-7-yl]silane |
|---|---|
| PubChem CID | 102473890 |
| Molecular Formula | C24H40Si2 |
| Molecular Weight | 384.76 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | trimethyl-[(3E,7E,11E)-2,2,13,13-tetramethyl-8-trimethylsilyltetradeca-3,7,11-trien-5,9-diyn-7-yl]silane |
| SMILES | CC(C)(C)/C=C/C#C/C(=C(/C#C/C=C/C(C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H40Si2/c1-23(2,3)19-15-13-17-21(25(7,8)9)22(26(10,11)12)18-14-16-20-24(4,5)6/h15-16,19-20H,1-12H3/b19-15+,20-16+,22-21+ |
| InChIKey | LWODPSONPBYUIU-QYAKDTCDSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|