C18H30Si3 — CID 11724226
3,3-bis(2-trimethylsilylethynyl)pent-4-en-1-ynyl-trimethylsilane (PubChem CID 11724226) has the molecular formula C18H30Si3 and a molecular weight of 330.70 g/mol. Its IUPAC name is 3,3-bis(2-trimethylsilylethynyl)pent-4-en-1-ynyl-trimethylsilane.
| Compound Name | 3,3-bis(2-trimethylsilylethynyl)pent-4-en-1-ynyl-trimethylsilane |
|---|---|
| PubChem CID | 11724226 |
| Molecular Formula | C18H30Si3 |
| Molecular Weight | 330.70 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3,3-bis(2-trimethylsilylethynyl)pent-4-en-1-ynyl-trimethylsilane |
| SMILES | C=CC(C#C[Si](C)(C)C)(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30Si3/c1-11-18(12-15-19(2,3)4,13-16-20(5,6)7)14-17-21(8,9)10/h11H,1H2,2-10H3 |
| InChIKey | ASNWWOXVABYLGE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|