C25H42Si2 — CID 86059374
[3-ethenyl-3-(2-triethylsilylethynyl)nona-1,4-diynyl]-triethylsilane (PubChem CID 86059374) has the molecular formula C25H42Si2 and a molecular weight of 398.78 g/mol. Its IUPAC name is [3-ethenyl-3-(2-triethylsilylethynyl)nona-1,4-diynyl]-triethylsilane.
| Compound Name | [3-ethenyl-3-(2-triethylsilylethynyl)nona-1,4-diynyl]-triethylsilane |
|---|---|
| PubChem CID | 86059374 |
| Molecular Formula | C25H42Si2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | [3-ethenyl-3-(2-triethylsilylethynyl)nona-1,4-diynyl]-triethylsilane |
| SMILES | C=CC(C#CCCCC)(C#C[Si](CC)(CC)CC)C#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H42Si2/c1-9-17-18-19-20-25(10-2,21-23-26(11-3,12-4)13-5)22-24-27(14-6,15-7)16-8/h10H,2,9,11-18H2,1,3-8H3 |
| InChIKey | AAEUSXGWNMDFPR-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|