C17H32Si2 — CID 11033675
tert-butyl-dimethyl-(8-trimethylsilylocta-1,2-dien-7-ynyl)silane (PubChem CID 11033675) has the molecular formula C17H32Si2 and a molecular weight of 292.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-(8-trimethylsilylocta-1,2-dien-7-ynyl)silane.
| Compound Name | tert-butyl-dimethyl-(8-trimethylsilylocta-1,2-dien-7-ynyl)silane |
|---|---|
| PubChem CID | 11033675 |
| Molecular Formula | C17H32Si2 |
| Molecular Weight | 292.62 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | tert-butyl-dimethyl-(8-trimethylsilylocta-1,2-dien-7-ynyl)silane |
| SMILES | CC(C)(C)[Si](C)(C)C=C=CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H32Si2/c1-17(2,3)19(7,8)16-14-12-10-9-11-13-15-18(4,5)6/h12,16H,9-11H2,1-8H3 |
| InChIKey | QEPWDHRTYQTRRZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|