C18H32Si — CID 11780808
trimethyl(pentadeca-6,7-dien-1-ynyl)silane (PubChem CID 11780808) has the molecular formula C18H32Si and a molecular weight of 276.54 g/mol. Its IUPAC name is trimethyl(pentadeca-6,7-dien-1-ynyl)silane.
| Compound Name | trimethyl(pentadeca-6,7-dien-1-ynyl)silane |
|---|---|
| PubChem CID | 11780808 |
| Molecular Formula | C18H32Si |
| Molecular Weight | 276.54 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | trimethyl(pentadeca-6,7-dien-1-ynyl)silane |
| SMILES | CCCCCCCC=C=CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H32Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2,3)4/h11,13H,5-10,14-16H2,1-4H3 |
| InChIKey | AQKYYBFLOLTSAT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|