C15H26Si — CID 11075369
dodeca-5,6-dien-1-ynyl(trimethyl)silane (PubChem CID 11075369) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is dodeca-5,6-dien-1-ynyl(trimethyl)silane.
| Compound Name | dodeca-5,6-dien-1-ynyl(trimethyl)silane |
|---|---|
| PubChem CID | 11075369 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | dodeca-5,6-dien-1-ynyl(trimethyl)silane |
| SMILES | CCCCCC=C=CCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H26Si/c1-5-6-7-8-9-10-11-12-13-14-15-16(2,3)4/h9,11H,5-8,12-13H2,1-4H3 |
| InChIKey | AYOLJESNPMMHPP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|