C19H34Si — CID 11109061
hexadeca-6,7-dien-1-ynyl(trimethyl)silane (PubChem CID 11109061) has the molecular formula C19H34Si and a molecular weight of 290.57 g/mol. Its IUPAC name is hexadeca-6,7-dien-1-ynyl(trimethyl)silane.
| Compound Name | hexadeca-6,7-dien-1-ynyl(trimethyl)silane |
|---|---|
| PubChem CID | 11109061 |
| Molecular Formula | C19H34Si |
| Molecular Weight | 290.57 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | hexadeca-6,7-dien-1-ynyl(trimethyl)silane |
| SMILES | CCCCCCCCC=C=CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H34Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2,3)4/h12,14H,5-11,15-17H2,1-4H3 |
| InChIKey | AFFUTICSWXJPAN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|