C20H36Si2 — CID 86059387
triethyl-[3-methyl-3-(2-triethylsilylethynyl)pent-4-en-1-ynyl]silane (PubChem CID 86059387) has the molecular formula C20H36Si2 and a molecular weight of 332.68 g/mol. Its IUPAC name is triethyl-[3-methyl-3-(2-triethylsilylethynyl)pent-4-en-1-ynyl]silane.
| Compound Name | triethyl-[3-methyl-3-(2-triethylsilylethynyl)pent-4-en-1-ynyl]silane |
|---|---|
| PubChem CID | 86059387 |
| Molecular Formula | C20H36Si2 |
| Molecular Weight | 332.68 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | triethyl-[3-methyl-3-(2-triethylsilylethynyl)pent-4-en-1-ynyl]silane |
| SMILES | C=CC(C)(C#C[Si](CC)(CC)CC)C#C[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H36Si2/c1-9-20(8,16-18-21(10-2,11-3)12-4)17-19-22(13-5,14-6)15-7/h9H,1,10-15H2,2-8H3 |
| InChIKey | GCNVKVQEBOMEJJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|