C18H34Si — CID 134966781
triethyl-[(E)-2,2,7,7-tetramethyloct-3-en-5-yn-3-yl]silane (PubChem CID 134966781) has the molecular formula C18H34Si and a molecular weight of 278.56 g/mol. Its IUPAC name is triethyl-[(E)-2,2,7,7-tetramethyloct-3-en-5-yn-3-yl]silane.
| Compound Name | triethyl-[(E)-2,2,7,7-tetramethyloct-3-en-5-yn-3-yl]silane |
|---|---|
| PubChem CID | 134966781 |
| Molecular Formula | C18H34Si |
| Molecular Weight | 278.56 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | triethyl-[(E)-2,2,7,7-tetramethyloct-3-en-5-yn-3-yl]silane |
| SMILES | CC[Si](CC)(CC)/C(=C/C#CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H34Si/c1-10-19(11-2,12-3)16(18(7,8)9)14-13-15-17(4,5)6/h14H,10-12H2,1-9H3/b16-14+ |
| InChIKey | VELSXNNXYXRWEV-JQIJEIRASA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|