C31H52Si — CID 11015863
trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane (PubChem CID 11015863) has the molecular formula C31H52Si and a molecular weight of 452.84 g/mol. Its IUPAC name is trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane.
| Compound Name | trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane |
|---|---|
| PubChem CID | 11015863 |
| Molecular Formula | C31H52Si |
| Molecular Weight | 452.84 g/mol |
| Exact Mass | 452.38 |
| IUPAC Name | trimethyl-[(5E,9E,13E,17E)-6,10,14,18,22-pentamethyltricosa-5,9,13,17,21-pentaen-1-ynyl]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C31H52Si/c1-27(2)17-13-19-29(4)21-15-23-31(6)25-16-24-30(5)22-14-20-28(3)18-11-10-12-26-32(7,8)9/h17-18,21-22,25H,10-11,13-16,19-20,23-24H2,1-9H3/b28-18+,29-21+,30-22+,31-25+ |
| InChIKey | RARKZGICDZBZEN-HUZMQAKGSA-N |
| XLogP | 10.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.84 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|