C51H84Si — CID 11216306
trimethyl-[(5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-ynyl]silane (PubChem CID 11216306) has the molecular formula C51H84Si and a molecular weight of 725.32 g/mol. Its IUPAC name is trimethyl-[(5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-ynyl]silane.
| Compound Name | trimethyl-[(5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-ynyl]silane |
|---|---|
| PubChem CID | 11216306 |
| Molecular Formula | C51H84Si |
| Molecular Weight | 725.32 g/mol |
| Exact Mass | 724.63 |
| IUPAC Name | trimethyl-[(5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-ynyl]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C51H84Si/c1-43(2)25-17-27-45(4)29-19-31-47(6)33-21-35-49(8)37-23-39-51(10)41-24-40-50(9)38-22-36-48(7)34-20-32-46(5)30-18-28-44(3)26-15-14-16-42-52(11,12)13/h25-26,29-30,33-34,37-38,41H,14-15,17-24,27-28,31-32,35-36,39-40H2,1-13H3/b44-26+,45-29+,46-30+,47-33+,48-34+,49-37+,50-38+,51-41+ |
| InChIKey | LWTWKAVRYYRCDV-BEHKIRPCSA-N |
| XLogP | 17.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.32 |
| LogP ≤ 5 | 17.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|