C23H38Si2 — CID 11474191
trimethyl-[(Z)-11-tri(propan-2-yl)silylundec-8-en-1,3,10-triynyl]silane (PubChem CID 11474191) has the molecular formula C23H38Si2 and a molecular weight of 370.73 g/mol. Its IUPAC name is trimethyl-[(Z)-11-tri(propan-2-yl)silylundec-8-en-1,3,10-triynyl]silane.
| Compound Name | trimethyl-[(Z)-11-tri(propan-2-yl)silylundec-8-en-1,3,10-triynyl]silane |
|---|---|
| PubChem CID | 11474191 |
| Molecular Formula | C23H38Si2 |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | trimethyl-[(Z)-11-tri(propan-2-yl)silylundec-8-en-1,3,10-triynyl]silane |
| SMILES | CC(C)[Si](C#C/C=C\CCCC#CC#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H38Si2/c1-21(2)25(22(3)4,23(5)6)20-18-16-14-12-10-11-13-15-17-19-24(7,8)9/h14,16,21-23H,10-12H2,1-9H3/b16-14- |
| InChIKey | CYSIDUWJSRZPAY-PEZBUJJGSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|