C26H41NSi — CID 102049415
3,3-diethyl-13-tri(propan-2-yl)silyltrideca-5,10,12-triynenitrile (PubChem CID 102049415) has the molecular formula C26H41NSi and a molecular weight of 395.71 g/mol. Its IUPAC name is 3,3-diethyl-13-tri(propan-2-yl)silyltrideca-5,10,12-triynenitrile.
| Compound Name | 3,3-diethyl-13-tri(propan-2-yl)silyltrideca-5,10,12-triynenitrile |
|---|---|
| PubChem CID | 102049415 |
| Molecular Formula | C26H41NSi |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | 3,3-diethyl-13-tri(propan-2-yl)silyltrideca-5,10,12-triynenitrile |
| SMILES | CCC(CC)(CC#N)CC#CCCCC#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H41NSi/c1-9-26(10-2,20-21-27)19-17-15-13-11-12-14-16-18-22-28(23(3)4,24(5)6)25(7)8/h23-25H,9-13,19-20H2,1-8H3 |
| InChIKey | AXTLQLVDQNTXIG-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|