C30H46O10Si — CID 132564361
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[7-tri(propan-2-yl)silylhepta-4,6-diynoxy]oxan-2-yl]methyl acetate (PubChem CID 132564361) has the molecular formula C30H46O10Si and a molecular weight of 594.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[7-tri(propan-2-yl)silylhepta-4,6-diynoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[7-tri(propan-2-yl)silylhepta-4,6-diynoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132564361 |
| Molecular Formula | C30H46O10Si |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[7-tri(propan-2-yl)silylhepta-4,6-diynoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCC#CC#C[Si](C(C)C)(C(C)C)C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H46O10Si/c1-19(2)41(20(3)4,21(5)6)17-15-13-11-12-14-16-35-30-29(39-25(10)34)28(38-24(9)33)27(37-23(8)32)26(40-30)18-36-22(7)31/h19-21,26-30H,12,14,16,18H2,1-10H3/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | GQKYSVYHCCJATP-CMPUJJQDSA-N |
| XLogP | 4.09 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|