C17H29ISi — CID 12052001
[(5E,9E)-12-iodo-6,10-dimethyldodeca-5,9-dien-1-ynyl]-trimethylsilane (PubChem CID 12052001) has the molecular formula C17H29ISi and a molecular weight of 388.41 g/mol. Its IUPAC name is [(5E,9E)-12-iodo-6,10-dimethyldodeca-5,9-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(5E,9E)-12-iodo-6,10-dimethyldodeca-5,9-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 12052001 |
| Molecular Formula | C17H29ISi |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(5E,9E)-12-iodo-6,10-dimethyldodeca-5,9-dien-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CC/C(C)=C/CCC#C[Si](C)(C)C)CCI |
| InChI | InChI=1S/C17H29ISi/c1-16(11-9-12-17(2)13-14-18)10-7-6-8-15-19(3,4)5/h10,12H,6-7,9,11,13-14H2,1-5H3/b16-10+,17-12+ |
| InChIKey | TZSUJHPZJRJUAQ-JTCWOHKRSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|