C22H37ISi — CID 11385539
[(5E,9E,13E)-16-iodo-6,10,14-trimethylhexadeca-5,9,13-trien-1-ynyl]-trimethylsilane (PubChem CID 11385539) has the molecular formula C22H37ISi and a molecular weight of 456.53 g/mol. Its IUPAC name is [(5E,9E,13E)-16-iodo-6,10,14-trimethylhexadeca-5,9,13-trien-1-ynyl]-trimethylsilane.
| Compound Name | [(5E,9E,13E)-16-iodo-6,10,14-trimethylhexadeca-5,9,13-trien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11385539 |
| Molecular Formula | C22H37ISi |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [(5E,9E,13E)-16-iodo-6,10,14-trimethylhexadeca-5,9,13-trien-1-ynyl]-trimethylsilane |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CCC#C[Si](C)(C)C)CCI |
| InChI | InChI=1S/C22H37ISi/c1-20(12-8-7-9-19-24(4,5)6)13-10-14-21(2)15-11-16-22(3)17-18-23/h12,14,16H,7-8,10-11,13,15,17-18H2,1-6H3/b20-12+,21-14+,22-16+ |
| InChIKey | OIAGEKSSWMIMCF-VOLDSXALSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|