C23H42Si — CID 102296161
tri(propan-2-yl)-[(3Z,5E)-3,4,5-triethylocta-3,5-dien-1-ynyl]silane (PubChem CID 102296161) has the molecular formula C23H42Si and a molecular weight of 346.68 g/mol. Its IUPAC name is tri(propan-2-yl)-[(3Z,5E)-3,4,5-triethylocta-3,5-dien-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[(3Z,5E)-3,4,5-triethylocta-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 102296161 |
| Molecular Formula | C23H42Si |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 346.31 |
| IUPAC Name | tri(propan-2-yl)-[(3Z,5E)-3,4,5-triethylocta-3,5-dien-1-ynyl]silane |
| SMILES | CC/C=C(CC)/C(CC)=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)CC |
| InChI | InChI=1S/C23H42Si/c1-11-15-21(12-2)23(14-4)22(13-3)16-17-24(18(5)6,19(7)8)20(9)10/h15,18-20H,11-14H2,1-10H3/b21-15+,23-22- |
| InChIKey | LFUXRLPHHJRIAB-BQNDYICTSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|