C14H24Si — CID 10900157
tert-butyl-dimethyl-octa-1,2-dien-7-ynylsilane (PubChem CID 10900157) has the molecular formula C14H24Si and a molecular weight of 220.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-octa-1,2-dien-7-ynylsilane.
| Compound Name | tert-butyl-dimethyl-octa-1,2-dien-7-ynylsilane |
|---|---|
| PubChem CID | 10900157 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | tert-butyl-dimethyl-octa-1,2-dien-7-ynylsilane |
| SMILES | C#CCCCC=C=C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24Si/c1-7-8-9-10-11-12-13-15(5,6)14(2,3)4/h1,11,13H,8-10H2,2-6H3 |
| InChIKey | SINANVAYOVHHQP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|