C14H26Si2 — CID 11010398
trimethyl(8-trimethylsilylocta-1,2-dien-7-ynyl)silane (PubChem CID 11010398) has the molecular formula C14H26Si2 and a molecular weight of 250.53 g/mol. Its IUPAC name is trimethyl(8-trimethylsilylocta-1,2-dien-7-ynyl)silane.
| Compound Name | trimethyl(8-trimethylsilylocta-1,2-dien-7-ynyl)silane |
|---|---|
| PubChem CID | 11010398 |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | trimethyl(8-trimethylsilylocta-1,2-dien-7-ynyl)silane |
| SMILES | C[Si](C)(C)C#CCCCC=C=C[Si](C)(C)C |
| InChI | InChI=1S/C14H26Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h9,13H,7-8,10H2,1-6H3 |
| InChIKey | WOJTXPASSYOVRD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|