C13H24Si2 — CID 11075440
trimethyl(7-trimethylsilylhepta-1,2-dien-6-ynyl)silane (PubChem CID 11075440) has the molecular formula C13H24Si2 and a molecular weight of 236.51 g/mol. Its IUPAC name is trimethyl(7-trimethylsilylhepta-1,2-dien-6-ynyl)silane.
| Compound Name | trimethyl(7-trimethylsilylhepta-1,2-dien-6-ynyl)silane |
|---|---|
| PubChem CID | 11075440 |
| Molecular Formula | C13H24Si2 |
| Molecular Weight | 236.51 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | trimethyl(7-trimethylsilylhepta-1,2-dien-6-ynyl)silane |
| SMILES | C[Si](C)(C)C#CCCC=C=C[Si](C)(C)C |
| InChI | InChI=1S/C13H24Si2/c1-14(2,3)12-10-8-7-9-11-13-15(4,5)6/h8,12H,7,9H2,1-6H3 |
| InChIKey | MSQVGKIIGWUSDB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|