About trimethyl(7-methylocta-5,6-dien-1-ynyl)silane
trimethyl(7-methylocta-5,6-dien-1-ynyl)silane (PubChem CID 11030650) has the molecular formula C12H20Si
and a molecular weight of 192.38 g/mol. Its IUPAC name is trimethyl(7-methylocta-5,6-dien-1-ynyl)silane.
Molecular Properties
| Compound Name | trimethyl(7-methylocta-5,6-dien-1-ynyl)silane |
| PubChem CID | 11030650 |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | trimethyl(7-methylocta-5,6-dien-1-ynyl)silane |
| SMILES | CC(C)=C=CCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20Si/c1-12(2)10-8-6-7-9-11-13(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | BHQUEIUZQDZPHA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(7-methylocta-5,6-dien-1-ynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(7-methylocta-5,6-dien-1-ynyl)silane?
The IUPAC name of trimethyl(7-methylocta-5,6-dien-1-ynyl)silane (CID 11030650) is trimethyl(7-methylocta-5,6-dien-1-ynyl)silane.
What is the SMILES notation for trimethyl(7-methylocta-5,6-dien-1-ynyl)silane?
The canonical SMILES for trimethyl(7-methylocta-5,6-dien-1-ynyl)silane is CC(C)=C=CCCC#C[Si](C)(C)C.
What is the InChIKey of trimethyl(7-methylocta-5,6-dien-1-ynyl)silane?
The InChIKey is BHQUEIUZQDZPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20Si/c1-12(2)10-8-6-7-9-11-13(3,4)5/h8H,6-7H2,1-5H3.
What are the key properties of trimethyl(7-methylocta-5,6-dien-1-ynyl)silane?
trimethyl(7-methylocta-5,6-dien-1-ynyl)silane has a molecular weight of 192.38 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(7-methylocta-5,6-dien-1-ynyl)silane is sourced from PubChem (CID 11030650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).