C14H22Si2 — CID 15191381
(3,4-dimethylidene-6-trimethylsilylhexa-1,5-diynyl)-trimethylsilane (PubChem CID 15191381) has the molecular formula C14H22Si2 and a molecular weight of 246.50 g/mol. Its IUPAC name is (3,4-dimethylidene-6-trimethylsilylhexa-1,5-diynyl)-trimethylsilane.
| Compound Name | (3,4-dimethylidene-6-trimethylsilylhexa-1,5-diynyl)-trimethylsilane |
|---|---|
| PubChem CID | 15191381 |
| Molecular Formula | C14H22Si2 |
| Molecular Weight | 246.50 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3,4-dimethylidene-6-trimethylsilylhexa-1,5-diynyl)-trimethylsilane |
| SMILES | C=C(C#C[Si](C)(C)C)C(=C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H22Si2/c1-13(9-11-15(3,4)5)14(2)10-12-16(6,7)8/h1-2H2,3-8H3 |
| InChIKey | AETMOKBTIJEWQK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|