C14H26Si2 — CID 14175474
trimethyl-[4-methyl-3-[(E)-2-trimethylsilylethenyl]pent-3-en-1-ynyl]silane (PubChem CID 14175474) has the molecular formula C14H26Si2 and a molecular weight of 250.53 g/mol. Its IUPAC name is trimethyl-[4-methyl-3-[(E)-2-trimethylsilylethenyl]pent-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[4-methyl-3-[(E)-2-trimethylsilylethenyl]pent-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 14175474 |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | trimethyl-[4-methyl-3-[(E)-2-trimethylsilylethenyl]pent-3-en-1-ynyl]silane |
| SMILES | CC(C)=C(C#C[Si](C)(C)C)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C14H26Si2/c1-13(2)14(9-11-15(3,4)5)10-12-16(6,7)8/h9,11H,1-8H3/b11-9+ |
| InChIKey | PKJIHKFLLHMHSU-PKNBQFBNSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|