C20H32Si2 — CID 10917651
trimethyl-[2-[2-[2-tri(propan-2-yl)silylethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]silane (PubChem CID 10917651) has the molecular formula C20H32Si2 and a molecular weight of 328.65 g/mol. Its IUPAC name is trimethyl-[2-[2-[2-tri(propan-2-yl)silylethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[2-[2-tri(propan-2-yl)silylethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 10917651 |
| Molecular Formula | C20H32Si2 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | trimethyl-[2-[2-[2-tri(propan-2-yl)silylethynyl]cyclobuta-1,3-dien-1-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#CC1=C(C#C[Si](C)(C)C)C=C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32Si2/c1-16(2)22(17(3)4,18(5)6)15-13-20-11-10-19(20)12-14-21(7,8)9/h10-11,16-18H,1-9H3 |
| InChIKey | PSIIBGPOZDFZTB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|