C20H36Si4 — CID 15912758
trimethyl-[3-trimethylsilyl-2,4-bis(2-trimethylsilylethynyl)cyclobuta-1,3-dien-1-yl]silane (PubChem CID 15912758) has the molecular formula C20H36Si4 and a molecular weight of 388.85 g/mol. Its IUPAC name is trimethyl-[3-trimethylsilyl-2,4-bis(2-trimethylsilylethynyl)cyclobuta-1,3-dien-1-yl]silane.
| Compound Name | trimethyl-[3-trimethylsilyl-2,4-bis(2-trimethylsilylethynyl)cyclobuta-1,3-dien-1-yl]silane |
|---|---|
| PubChem CID | 15912758 |
| Molecular Formula | C20H36Si4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | trimethyl-[3-trimethylsilyl-2,4-bis(2-trimethylsilylethynyl)cyclobuta-1,3-dien-1-yl]silane |
| SMILES | C[Si](C)(C)C#CC1=C([Si](C)(C)C)C(C#C[Si](C)(C)C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C20H36Si4/c1-21(2,3)15-13-17-19(23(7,8)9)18(14-16-22(4,5)6)20(17)24(10,11)12/h1-12H3 |
| InChIKey | URCBOBKBLCDNJF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|