C22H22Si2 — CID 12061733
trimethyl-[(4Z,10Z)-16-trimethylsilyl-15-bicyclo[12.2.0]hexadeca-1(14),4,10,15-tetraen-2,6,8,12-tetraynyl]silane (PubChem CID 12061733) has the molecular formula C22H22Si2 and a molecular weight of 342.59 g/mol. Its IUPAC name is trimethyl-[(4Z,10Z)-16-trimethylsilyl-15-bicyclo[12.2.0]hexadeca-1(14),4,10,15-tetraen-2,6,8,12-tetraynyl]silane.
| Compound Name | trimethyl-[(4Z,10Z)-16-trimethylsilyl-15-bicyclo[12.2.0]hexadeca-1(14),4,10,15-tetraen-2,6,8,12-tetraynyl]silane |
|---|---|
| PubChem CID | 12061733 |
| Molecular Formula | C22H22Si2 |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | trimethyl-[(4Z,10Z)-16-trimethylsilyl-15-bicyclo[12.2.0]hexadeca-1(14),4,10,15-tetraen-2,6,8,12-tetraynyl]silane |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)c2c#cccc#cc#cccc#cc21 |
| InChI | InChI=1S/C22H22Si2/c1-23(2,3)21-19-17-15-13-11-9-7-8-10-12-14-16-18-20(19)22(21)24(4,5)6/h11-14H,1-6H3/b13-11-,14-12- |
| InChIKey | CPIIXZZFAQAQOI-XSYHWHKQSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|