C17H28Si2 — CID 154721469
trimethyl-[3-propan-2-ylidene-4-(2-trimethylsilylethynyl)hex-4-en-1-ynyl]silane (PubChem CID 154721469) has the molecular formula C17H28Si2 and a molecular weight of 288.58 g/mol. Its IUPAC name is trimethyl-[3-propan-2-ylidene-4-(2-trimethylsilylethynyl)hex-4-en-1-ynyl]silane.
| Compound Name | trimethyl-[3-propan-2-ylidene-4-(2-trimethylsilylethynyl)hex-4-en-1-ynyl]silane |
|---|---|
| PubChem CID | 154721469 |
| Molecular Formula | C17H28Si2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | trimethyl-[3-propan-2-ylidene-4-(2-trimethylsilylethynyl)hex-4-en-1-ynyl]silane |
| SMILES | CC=C(C#C[Si](C)(C)C)C(C#C[Si](C)(C)C)=C(C)C |
| InChI | InChI=1S/C17H28Si2/c1-10-16(11-13-18(4,5)6)17(15(2)3)12-14-19(7,8)9/h10H,1-9H3 |
| InChIKey | UNWXUZWXNLEPER-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|