C12H18Si — CID 173466997
trimethyl-[(4Z)-5-methyl-3-methylidenehepta-4,6-dien-1-ynyl]silane (PubChem CID 173466997) has the molecular formula C12H18Si and a molecular weight of 190.36 g/mol. Its IUPAC name is trimethyl-[(4Z)-5-methyl-3-methylidenehepta-4,6-dien-1-ynyl]silane.
| Compound Name | trimethyl-[(4Z)-5-methyl-3-methylidenehepta-4,6-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 173466997 |
| Molecular Formula | C12H18Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | trimethyl-[(4Z)-5-methyl-3-methylidenehepta-4,6-dien-1-ynyl]silane |
| SMILES | C=C/C(C)=C\C(=C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H18Si/c1-7-11(2)10-12(3)8-9-13(4,5)6/h7,10H,1,3H2,2,4-6H3/b11-10- |
| InChIKey | PHEQVJOMRUHZRK-KHPPLWFESA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|