C36H54Si6 — CID 15194666
[3-[2,3-bis[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]cyclopropylidene]-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane (PubChem CID 15194666) has the molecular formula C36H54Si6 and a molecular weight of 655.34 g/mol. Its IUPAC name is [3-[2,3-bis[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]cyclopropylidene]-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane.
| Compound Name | [3-[2,3-bis[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]cyclopropylidene]-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 15194666 |
| Molecular Formula | C36H54Si6 |
| Molecular Weight | 655.34 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | [3-[2,3-bis[1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ylidene]cyclopropylidene]-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(C#C[Si](C)(C)C)=C1C(=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C)C1=C(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C36H54Si6/c1-37(2,3)25-19-31(20-26-38(4,5)6)34-35(32(21-27-39(7,8)9)22-28-40(10,11)12)36(34)33(23-29-41(13,14)15)24-30-42(16,17)18/h1-18H3 |
| InChIKey | NGAMWPXHDJMGOR-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.34 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|