C34H44Si2 — CID 12011032
4-[3,4-diethynyl-2-[4-tri(propan-2-yl)silylbuta-1,3-diynyl]cyclobuta-1,3-dien-1-yl]buta-1,3-diynyl-tri(propan-2-yl)silane (PubChem CID 12011032) has the molecular formula C34H44Si2 and a molecular weight of 508.90 g/mol. Its IUPAC name is 4-[3,4-diethynyl-2-[4-tri(propan-2-yl)silylbuta-1,3-diynyl]cyclobuta-1,3-dien-1-yl]buta-1,3-diynyl-tri(propan-2-yl)silane.
| Compound Name | 4-[3,4-diethynyl-2-[4-tri(propan-2-yl)silylbuta-1,3-diynyl]cyclobuta-1,3-dien-1-yl]buta-1,3-diynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 12011032 |
| Molecular Formula | C34H44Si2 |
| Molecular Weight | 508.90 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 4-[3,4-diethynyl-2-[4-tri(propan-2-yl)silylbuta-1,3-diynyl]cyclobuta-1,3-dien-1-yl]buta-1,3-diynyl-tri(propan-2-yl)silane |
| SMILES | C#CC1=C(C#C)C(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)=C1C#CC#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H44Si2/c1-15-31-32(16-2)34(22-18-20-24-36(28(9)10,29(11)12)30(13)14)33(31)21-17-19-23-35(25(3)4,26(5)6)27(7)8/h1-2,25-30H,3-14H3 |
| InChIKey | MEWYZJIGHMDDAR-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.90 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|