C14H20Si2 — CID 15784008
(2,4-diethynyl-3-trimethylsilylcyclobuta-1,3-dien-1-yl)-trimethylsilane (PubChem CID 15784008) has the molecular formula C14H20Si2 and a molecular weight of 244.49 g/mol. Its IUPAC name is (2,4-diethynyl-3-trimethylsilylcyclobuta-1,3-dien-1-yl)-trimethylsilane.
| Compound Name | (2,4-diethynyl-3-trimethylsilylcyclobuta-1,3-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15784008 |
| Molecular Formula | C14H20Si2 |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2,4-diethynyl-3-trimethylsilylcyclobuta-1,3-dien-1-yl)-trimethylsilane |
| SMILES | C#CC1=C([Si](C)(C)C)C(C#C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C14H20Si2/c1-9-11-13(15(3,4)5)12(10-2)14(11)16(6,7)8/h1-2H,3-8H3 |
| InChIKey | JYBXGWIZZPTVPS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|