C11H12Si — CID 10881504
2-(2-ethynylcyclobuta-1,3-dien-1-yl)ethynyl-trimethylsilane (PubChem CID 10881504) has the molecular formula C11H12Si and a molecular weight of 172.30 g/mol. Its IUPAC name is 2-(2-ethynylcyclobuta-1,3-dien-1-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(2-ethynylcyclobuta-1,3-dien-1-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10881504 |
| Molecular Formula | C11H12Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(2-ethynylcyclobuta-1,3-dien-1-yl)ethynyl-trimethylsilane |
| SMILES | C#CC1=C(C#C[Si](C)(C)C)C=C1 |
| InChI | InChI=1S/C11H12Si/c1-5-10-6-7-11(10)8-9-12(2,3)4/h1,6-7H,2-4H3 |
| InChIKey | HYEBQZMOPWTGPY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|