C16H28Si2 — CID 15448262
[(Z)-3,4-diethyl-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 15448262) has the molecular formula C16H28Si2 and a molecular weight of 276.57 g/mol. Its IUPAC name is [(Z)-3,4-diethyl-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(Z)-3,4-diethyl-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 15448262 |
| Molecular Formula | C16H28Si2 |
| Molecular Weight | 276.57 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(Z)-3,4-diethyl-6-trimethylsilylhex-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | CC/C(C#C[Si](C)(C)C)=C(/C#C[Si](C)(C)C)CC |
| InChI | InChI=1S/C16H28Si2/c1-9-15(11-13-17(3,4)5)16(10-2)12-14-18(6,7)8/h9-10H2,1-8H3/b16-15- |
| InChIKey | QHTLWAWUDPCNJG-NXVVXOECSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|