C17H34Si2 — CID 134963826
trimethyl-[(E)-3-propyl-4-trimethylsilyloct-3-en-1-ynyl]silane (PubChem CID 134963826) has the molecular formula C17H34Si2 and a molecular weight of 294.63 g/mol. Its IUPAC name is trimethyl-[(E)-3-propyl-4-trimethylsilyloct-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(E)-3-propyl-4-trimethylsilyloct-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 134963826 |
| Molecular Formula | C17H34Si2 |
| Molecular Weight | 294.63 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | trimethyl-[(E)-3-propyl-4-trimethylsilyloct-3-en-1-ynyl]silane |
| SMILES | CCCC/C(=C(\C#C[Si](C)(C)C)CCC)[Si](C)(C)C |
| InChI | InChI=1S/C17H34Si2/c1-9-11-13-17(19(6,7)8)16(12-10-2)14-15-18(3,4)5/h9-13H2,1-8H3/b17-16+ |
| InChIKey | GQCCKWLYYCGOEK-WUKNDPDISA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|