C18H30Si2 — CID 134997996
triethyl-[6-(2-trimethylsilylcyclopropen-1-yl)hexa-1,3-diynyl]silane (PubChem CID 134997996) has the molecular formula C18H30Si2 and a molecular weight of 302.61 g/mol. Its IUPAC name is triethyl-[6-(2-trimethylsilylcyclopropen-1-yl)hexa-1,3-diynyl]silane.
| Compound Name | triethyl-[6-(2-trimethylsilylcyclopropen-1-yl)hexa-1,3-diynyl]silane |
|---|---|
| PubChem CID | 134997996 |
| Molecular Formula | C18H30Si2 |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | triethyl-[6-(2-trimethylsilylcyclopropen-1-yl)hexa-1,3-diynyl]silane |
| SMILES | CC[Si](C#CC#CCCC1=C([Si](C)(C)C)C1)(CC)CC |
| InChI | InChI=1S/C18H30Si2/c1-7-20(8-2,9-3)15-13-11-10-12-14-17-16-18(17)19(4,5)6/h7-9,12,14,16H2,1-6H3 |
| InChIKey | KVPBFDBQQVQPLO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|