C19H32Si — CID 10017015
[(Z)-3-butyl-4-ethyldec-3-en-1,5-diynyl]-trimethylsilane (PubChem CID 10017015) has the molecular formula C19H32Si and a molecular weight of 288.55 g/mol. Its IUPAC name is [(Z)-3-butyl-4-ethyldec-3-en-1,5-diynyl]-trimethylsilane.
| Compound Name | [(Z)-3-butyl-4-ethyldec-3-en-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10017015 |
| Molecular Formula | C19H32Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [(Z)-3-butyl-4-ethyldec-3-en-1,5-diynyl]-trimethylsilane |
| SMILES | CCCCC#C/C(CC)=C(\C#C[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C19H32Si/c1-7-10-12-13-15-18(9-3)19(14-11-8-2)16-17-20(4,5)6/h7-12,14H2,1-6H3/b19-18- |
| InChIKey | WLNNTNQCBNTDCC-HNENSFHCSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|