C28H44Si4 — CID 15266021
trimethyl-[2-[(1Z,5Z)-2,5,6-tris(2-trimethylsilylethynyl)cycloocta-1,5-dien-1-yl]ethynyl]silane (PubChem CID 15266021) has the molecular formula C28H44Si4 and a molecular weight of 493.00 g/mol. Its IUPAC name is trimethyl-[2-[(1Z,5Z)-2,5,6-tris(2-trimethylsilylethynyl)cycloocta-1,5-dien-1-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(1Z,5Z)-2,5,6-tris(2-trimethylsilylethynyl)cycloocta-1,5-dien-1-yl]ethynyl]silane |
|---|---|
| PubChem CID | 15266021 |
| Molecular Formula | C28H44Si4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | trimethyl-[2-[(1Z,5Z)-2,5,6-tris(2-trimethylsilylethynyl)cycloocta-1,5-dien-1-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#C/C1=C(\C#C[Si](C)(C)C)CC/C(C#C[Si](C)(C)C)=C(/C#C[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C28H44Si4/c1-29(2,3)21-17-25-13-14-27(19-23-31(7,8)9)28(20-24-32(10,11)12)16-15-26(25)18-22-30(4,5)6/h13-16H2,1-12H3/b26-25-,28-27- |
| InChIKey | MPYNLJJLVCUOFS-FNBANUKLSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|