C32H44Si2 — CID 135046217
[3,9-di(cyclohexylidene)-6-propan-2-ylidene-11-trimethylsilylundeca-1,4,7,10-tetraynyl]-trimethylsilane (PubChem CID 135046217) has the molecular formula C32H44Si2 and a molecular weight of 484.88 g/mol. Its IUPAC name is [3,9-di(cyclohexylidene)-6-propan-2-ylidene-11-trimethylsilylundeca-1,4,7,10-tetraynyl]-trimethylsilane.
| Compound Name | [3,9-di(cyclohexylidene)-6-propan-2-ylidene-11-trimethylsilylundeca-1,4,7,10-tetraynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135046217 |
| Molecular Formula | C32H44Si2 |
| Molecular Weight | 484.88 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | [3,9-di(cyclohexylidene)-6-propan-2-ylidene-11-trimethylsilylundeca-1,4,7,10-tetraynyl]-trimethylsilane |
| SMILES | CC(C)=C(C#CC(C#C[Si](C)(C)C)=C1CCCCC1)C#CC(C#C[Si](C)(C)C)=C1CCCCC1 |
| InChI | InChI=1S/C32H44Si2/c1-27(2)28(19-21-31(23-25-33(3,4)5)29-15-11-9-12-16-29)20-22-32(24-26-34(6,7)8)30-17-13-10-14-18-30/h9-18H2,1-8H3 |
| InChIKey | NHXQIRNGJCURJH-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.88 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|