C40H62Si2 — CID 101194213
[3,8-di(cyclohexylidene)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane (PubChem CID 101194213) has the molecular formula C40H62Si2 and a molecular weight of 599.11 g/mol. Its IUPAC name is [3,8-di(cyclohexylidene)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane.
| Compound Name | [3,8-di(cyclohexylidene)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101194213 |
| Molecular Formula | C40H62Si2 |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | [3,8-di(cyclohexylidene)-10-tri(propan-2-yl)silyldeca-1,4,6,9-tetraynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC(C#CC#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1CCCCC1)=C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H62Si2/c1-31(2)41(32(3)4,33(5)6)29-27-39(37-21-15-13-16-22-37)25-19-20-26-40(38-23-17-14-18-24-38)28-30-42(34(7)8,35(9)10)36(11)12/h31-36H,13-18,21-24H2,1-12H3 |
| InChIKey | OYULTKZUDOETTJ-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|