C32H54Si2 — CID 15534917
7,7-ditert-butyl-8-[2-(7,7-ditert-butyl-7-silabicyclo[4.2.0]oct-1(8)-en-8-yl)ethynyl]-7-silabicyclo[4.2.0]oct-1(8)-ene (PubChem CID 15534917) has the molecular formula C32H54Si2 and a molecular weight of 494.96 g/mol. Its IUPAC name is 7,7-ditert-butyl-8-[2-(7,7-ditert-butyl-7-silabicyclo[4.2.0]oct-1(8)-en-8-yl)ethynyl]-7-silabicyclo[4.2.0]oct-1(8)-ene.
| Compound Name | 7,7-ditert-butyl-8-[2-(7,7-ditert-butyl-7-silabicyclo[4.2.0]oct-1(8)-en-8-yl)ethynyl]-7-silabicyclo[4.2.0]oct-1(8)-ene |
|---|---|
| PubChem CID | 15534917 |
| Molecular Formula | C32H54Si2 |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | 7,7-ditert-butyl-8-[2-(7,7-ditert-butyl-7-silabicyclo[4.2.0]oct-1(8)-en-8-yl)ethynyl]-7-silabicyclo[4.2.0]oct-1(8)-ene |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)C(C#CC2=C3CCCCC3[Si]2(C(C)(C)C)C(C)(C)C)=C2CCCCC21 |
| InChI | InChI=1S/C32H54Si2/c1-29(2,3)33(30(4,5)6)25-19-15-13-17-23(25)27(33)21-22-28-24-18-14-16-20-26(24)34(28,31(7,8)9)32(10,11)12/h25-26H,13-20H2,1-12H3 |
| InChIKey | HCGIQHABINEHSD-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|