C44H56Si2 — CID 134901393
[6,12-di(cyclohexylidene)-16-methyl-3,9-di(propan-2-ylidene)-15-(2-trimethylsilylethynyl)heptadec-15-en-1,4,7,10,13-pentaynyl]-trimethylsilane (PubChem CID 134901393) has the molecular formula C44H56Si2 and a molecular weight of 641.10 g/mol. Its IUPAC name is [6,12-di(cyclohexylidene)-16-methyl-3,9-di(propan-2-ylidene)-15-(2-trimethylsilylethynyl)heptadec-15-en-1,4,7,10,13-pentaynyl]-trimethylsilane.
| Compound Name | [6,12-di(cyclohexylidene)-16-methyl-3,9-di(propan-2-ylidene)-15-(2-trimethylsilylethynyl)heptadec-15-en-1,4,7,10,13-pentaynyl]-trimethylsilane |
|---|---|
| PubChem CID | 134901393 |
| Molecular Formula | C44H56Si2 |
| Molecular Weight | 641.10 g/mol |
| Exact Mass | 640.39 |
| IUPAC Name | [6,12-di(cyclohexylidene)-16-methyl-3,9-di(propan-2-ylidene)-15-(2-trimethylsilylethynyl)heptadec-15-en-1,4,7,10,13-pentaynyl]-trimethylsilane |
| SMILES | CC(C)=C(C#CC(C#CC(C#C[Si](C)(C)C)=C(C)C)=C1CCCCC1)C#CC(C#CC(C#C[Si](C)(C)C)=C(C)C)=C1CCCCC1 |
| InChI | InChI=1S/C44H56Si2/c1-35(2)38(23-27-43(41-19-15-13-16-20-41)29-25-39(36(3)4)31-33-45(7,8)9)24-28-44(42-21-17-14-18-22-42)30-26-40(37(5)6)32-34-46(10,11)12/h13-22H2,1-12H3 |
| InChIKey | KDRRQRKEULPTEC-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.10 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|