C36H64Si2 — CID 100967830
[(Z)-3,4-dicyclohexyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane (PubChem CID 100967830) has the molecular formula C36H64Si2 and a molecular weight of 553.08 g/mol. Its IUPAC name is [(Z)-3,4-dicyclohexyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [(Z)-3,4-dicyclohexyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 100967830 |
| Molecular Formula | C36H64Si2 |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.45 |
| IUPAC Name | [(Z)-3,4-dicyclohexyl-6-tri(propan-2-yl)silylhex-3-en-1,5-diynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#C/C(=C(\C#C[Si](C(C)C)(C(C)C)C(C)C)C1CCCCC1)C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H64Si2/c1-27(2)37(28(3)4,29(5)6)25-23-35(33-19-15-13-16-20-33)36(34-21-17-14-18-22-34)24-26-38(30(7)8,31(9)10)32(11)12/h27-34H,13-22H2,1-12H3/b36-35- |
| InChIKey | QJUGJYROAYWOTJ-KXYMVQBMSA-N |
| XLogP | 11.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|