C21H32Si2 — CID 10688552
[3-(2-adamantylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane (PubChem CID 10688552) has the molecular formula C21H32Si2 and a molecular weight of 340.66 g/mol. Its IUPAC name is [3-(2-adamantylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane.
| Compound Name | [3-(2-adamantylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10688552 |
| Molecular Formula | C21H32Si2 |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | [3-(2-adamantylidene)-5-trimethylsilylpenta-1,4-diynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC(C#C[Si](C)(C)C)=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H32Si2/c1-22(2,3)9-7-18(8-10-23(4,5)6)21-19-12-16-11-17(14-19)15-20(21)13-16/h16-17,19-20H,11-15H2,1-6H3 |
| InChIKey | ZZJWYCLYRIFCCV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|