C47H60Si2 — CID 11028819
trimethyl-[3,6,9-tris(2-adamantylidene)-11-trimethylsilylundeca-1,4,7,10-tetraynyl]silane (PubChem CID 11028819) has the molecular formula C47H60Si2 and a molecular weight of 681.17 g/mol. Its IUPAC name is trimethyl-[3,6,9-tris(2-adamantylidene)-11-trimethylsilylundeca-1,4,7,10-tetraynyl]silane.
| Compound Name | trimethyl-[3,6,9-tris(2-adamantylidene)-11-trimethylsilylundeca-1,4,7,10-tetraynyl]silane |
|---|---|
| PubChem CID | 11028819 |
| Molecular Formula | C47H60Si2 |
| Molecular Weight | 681.17 g/mol |
| Exact Mass | 680.42 |
| IUPAC Name | trimethyl-[3,6,9-tris(2-adamantylidene)-11-trimethylsilylundeca-1,4,7,10-tetraynyl]silane |
| SMILES | C[Si](C)(C)C#CC(C#CC(C#CC(C#C[Si](C)(C)C)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3)=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C47H60Si2/c1-48(2,3)13-11-37(46-41-22-32-16-33(24-41)25-42(46)23-32)9-7-36(45-39-18-30-15-31(20-39)21-40(45)19-30)8-10-38(12-14-49(4,5)6)47-43-26-34-17-35(28-43)29-44(47)27-34/h30-35,39-44H,15-29H2,1-6H3/b45-36?,46-37-,47-38- |
| InChIKey | IXGNSSUDMQKCKT-LTCBHOBJSA-N |
| XLogP | 11.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.17 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|